C8H11NO3 — CID 54399008
2-hydroxy-4,5,6,7-tetrahydroisoindole-1,3-diol (PubChem CID 54399008) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is 2-hydroxy-4,5,6,7-tetrahydroisoindole-1,3-diol.
| Compound Name | 2-hydroxy-4,5,6,7-tetrahydroisoindole-1,3-diol |
|---|---|
| PubChem CID | 54399008 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-hydroxy-4,5,6,7-tetrahydroisoindole-1,3-diol |
| SMILES | Oc1c2c(c(O)n1O)CCCC2 |
| InChI | InChI=1S/C8H11NO3/c10-7-5-3-1-2-4-6(5)8(11)9(7)12/h10-12H,1-4H2 |
| InChIKey | VMBNVWVSZSSDJP-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 65.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|