C15H8ClN3O5S — CID 54403408
6-chloro-7-[2-(2-nitrophenyl)ethenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid (PubChem CID 54403408) has the molecular formula C15H8ClN3O5S and a molecular weight of 377.77 g/mol. Its IUPAC name is 6-chloro-7-[2-(2-nitrophenyl)ethenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid.
| Compound Name | 6-chloro-7-[2-(2-nitrophenyl)ethenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid |
|---|---|
| PubChem CID | 54403408 |
| Molecular Formula | C15H8ClN3O5S |
| Molecular Weight | 377.77 g/mol |
| Exact Mass | 376.99 |
| IUPAC Name | 6-chloro-7-[2-(2-nitrophenyl)ethenyl]-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-2-carboxylic acid |
| SMILES | O=C(O)c1cn2c(=O)c(Cl)c(C=Cc3ccccc3[N+](=O)[O-])nc2s1 |
| InChI | InChI=1S/C15H8ClN3O5S/c16-12-9(6-5-8-3-1-2-4-10(8)19(23)24)17-15-18(13(12)20)7-11(25-15)14(21)22/h1-7H,(H,21,22) |
| InChIKey | VPAIDJHSCHADQP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.77 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|