C31H44N4O — CID 54404500
N-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]-2-(diethylamino)-N-propylbenzamide (PubChem CID 54404500) has the molecular formula C31H44N4O and a molecular weight of 488.72 g/mol. Its IUPAC name is N-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]-2-(diethylamino)-N-propylbenzamide.
| Compound Name | N-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]-2-(diethylamino)-N-propylbenzamide |
|---|---|
| PubChem CID | 54404500 |
| Molecular Formula | C31H44N4O |
| Molecular Weight | 488.72 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | N-[3-(1-butylpiperidin-4-yl)-1H-indol-5-yl]-2-(diethylamino)-N-propylbenzamide |
| SMILES | CCCCN1CCC(c2c[nH]c3ccc(N(CCC)C(=O)c4ccccc4N(CC)CC)cc23)CC1 |
| InChI | InChI=1S/C31H44N4O/c1-5-9-19-33-20-16-24(17-21-33)28-23-32-29-15-14-25(22-27(28)29)35(18-6-2)31(36)26-12-10-11-13-30(26)34(7-3)8-4/h10-15,22-24,32H,5-9,16-21H2,1-4H3 |
| InChIKey | VPSFHTATHNUMTP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 42.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.72 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |