About 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol
4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol (PubChem CID 54408422) has the molecular formula C20H34O2
and a molecular weight of 306.49 g/mol. Its IUPAC name is 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol.
Molecular Properties
| Compound Name | 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol |
| PubChem CID | 54408422 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol |
| SMILES | CCC(C)C1CCC(O)CC1.CCC(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C10H20O.C10H14O/c2*1-3-8(2)9-4-6-10(11)7-5-9/h8-11H,3-7H2,1-2H3;4-8,11H,3H2,1-2H3 |
| InChIKey | VSJWQISWQPEFTD-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol?
The IUPAC name of 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol (CID 54408422) is 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol.
What is the SMILES notation for 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol?
The canonical SMILES for 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol is CCC(C)C1CCC(O)CC1.CCC(C)c1ccc(O)cc1.
What is the InChIKey of 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol?
The InChIKey is VSJWQISWQPEFTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20O.C10H14O/c2*1-3-8(2)9-4-6-10(11)7-5-9/h8-11H,3-7H2,1-2H3;4-8,11H,3H2,1-2H3.
What are the key properties of 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol?
4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol has a molecular weight of 306.49 g/mol, XLogP of 5.49, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-butan-2-ylcyclohexan-1-ol;4-butan-2-ylphenol is sourced from PubChem (CID 54408422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).