C18H34N6O4 — CID 54409944
(2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-piperazin-1-ylpiperazine-1-carboxamide (PubChem CID 54409944) has the molecular formula C18H34N6O4 and a molecular weight of 398.51 g/mol. Its IUPAC name is (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-piperazin-1-ylpiperazine-1-carboxamide.
| Compound Name | (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-piperazin-1-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 54409944 |
| Molecular Formula | C18H34N6O4 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | (2S)-2-[(2R)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-piperazin-1-ylpiperazine-1-carboxamide |
| SMILES | CCCCC[C@H](CC(=O)NO)C(=O)[C@@H]1CNCCN1C(=O)NN1CCNCC1 |
| InChI | InChI=1S/C18H34N6O4/c1-2-3-4-5-14(12-16(25)22-28)17(26)15-13-20-8-11-24(15)18(27)21-23-9-6-19-7-10-23/h14-15,19-20,28H,2-13H2,1H3,(H,21,27)(H,22,25)/t14-,15+/m1/s1 |
| InChIKey | VTJZHMUMDUXMFG-CABCVRRESA-N |
| XLogP | -0.55 |
| TPSA | 126.04 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | -0.55 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|