C22H40N4O5 — CID 10433388
(3R)-2-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-[(3R,4R)-3-methyl-5-oxoheptan-4-yl]diazinane-3-carboxamide (PubChem CID 10433388) has the molecular formula C22H40N4O5 and a molecular weight of 440.59 g/mol. Its IUPAC name is (3R)-2-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-[(3R,4R)-3-methyl-5-oxoheptan-4-yl]diazinane-3-carboxamide.
| Compound Name | (3R)-2-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-[(3R,4R)-3-methyl-5-oxoheptan-4-yl]diazinane-3-carboxamide |
|---|---|
| PubChem CID | 10433388 |
| Molecular Formula | C22H40N4O5 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.30 |
| IUPAC Name | (3R)-2-[(2S)-2-[2-(hydroxyamino)-2-oxoethyl]heptanoyl]-N-[(3R,4R)-3-methyl-5-oxoheptan-4-yl]diazinane-3-carboxamide |
| SMILES | CCCCC[C@@H](CC(=O)NO)C(=O)N1NCCC[C@@H]1C(=O)N[C@@H](C(=O)CC)[C@H](C)CC |
| InChI | InChI=1S/C22H40N4O5/c1-5-8-9-11-16(14-19(28)25-31)22(30)26-17(12-10-13-23-26)21(29)24-20(15(4)6-2)18(27)7-3/h15-17,20,23,31H,5-14H2,1-4H3,(H,24,29)(H,25,28)/t15-,16+,17-,20-/m1/s1 |
| InChIKey | IWWYEUSBHSDVOX-AXVVYFOYSA-N |
| XLogP | 2.08 |
| TPSA | 127.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|