methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate

C21H21NO4 — CID 54410746

IUPACmethyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate
SMILESCOC(=O)C1C(=O)C[C@@H](Cc2ccccc2)N(Cc2ccccc2)C1=O
InChIInChI=1S/C21H21NO4/c1-26-21(25)19-18(23)13-17(12-15-8-4-2-5-9-15)22(20(19)24)14-16-10-6-3-7-11-16/h2-11,17,19H,12-14H2,1H3/t17-,19?/m1/s1
InChIKeyVTYBFJARUKACCW-DUSLRRAJSA-N
MW351.40 g/mol
LogP2.39
Rot. Bonds5

About methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate

methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 54410746) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate.

Molecular Properties

Compound Namemethyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate
PubChem CID54410746
Molecular FormulaC21H21NO4
Molecular Weight351.40 g/mol
Exact Mass351.15
IUPAC Namemethyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate
SMILESCOC(=O)C1C(=O)C[C@@H](Cc2ccccc2)N(Cc2ccccc2)C1=O
InChIInChI=1S/C21H21NO4/c1-26-21(25)19-18(23)13-17(12-15-8-4-2-5-9-15)22(20(19)24)14-16-10-6-3-7-11-16/h2-11,17,19H,12-14H2,1H3/t17-,19?/m1/s1
InChIKeyVTYBFJARUKACCW-DUSLRRAJSA-N
XLogP2.39
TPSA63.68 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms26
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500351.40
LogP ≤ 52.39
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}

Analyze methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate?
The IUPAC name of methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate (CID 54410746) is methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate.
What is the SMILES notation for methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate?
The canonical SMILES for methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate is COC(=O)C1C(=O)C[C@@H](Cc2ccccc2)N(Cc2ccccc2)C1=O.
What is the InChIKey of methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate?
The InChIKey is VTYBFJARUKACCW-DUSLRRAJSA-N. The full InChI is InChI=1S/C21H21NO4/c1-26-21(25)19-18(23)13-17(12-15-8-4-2-5-9-15)22(20(19)24)14-16-10-6-3-7-11-16/h2-11,17,19H,12-14H2,1H3/t17-,19?/m1/s1.
What are the key properties of methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate?
methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate has a molecular weight of 351.40 g/mol, XLogP of 2.39, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate is sourced from PubChem (CID 54410746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).