C21H21NO4 — CID 54410746
methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate (PubChem CID 54410746) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate.
| Compound Name | methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate |
|---|---|
| PubChem CID | 54410746 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | methyl (6R)-1,6-dibenzyl-2,4-dioxopiperidine-3-carboxylate |
| SMILES | COC(=O)C1C(=O)C[C@@H](Cc2ccccc2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C21H21NO4/c1-26-21(25)19-18(23)13-17(12-15-8-4-2-5-9-15)22(20(19)24)14-16-10-6-3-7-11-16/h2-11,17,19H,12-14H2,1H3/t17-,19?/m1/s1 |
| InChIKey | VTYBFJARUKACCW-DUSLRRAJSA-N |
| XLogP | 2.39 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|