C26H40NO7P — CID 54418065
(2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxybutanoic acid (PubChem CID 54418065) has the molecular formula C26H40NO7P and a molecular weight of 509.58 g/mol. Its IUPAC name is (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxybutanoic acid.
| Compound Name | (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxybutanoic acid |
|---|---|
| PubChem CID | 54418065 |
| Molecular Formula | C26H40NO7P |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.25 |
| IUPAC Name | (2S,3R)-2-(docosa-2,4,6,8,10,12-hexaenoylamino)-3-phosphonooxybutanoic acid |
| SMILES | CCCCCCCCCC=CC=CC=CC=CC=CC=CC(=O)N[C@H](C(=O)O)[C@@H](C)OP(=O)(O)O |
| InChI | InChI=1S/C26H40NO7P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(28)27-25(26(29)30)23(2)34-35(31,32)33/h11-23,25H,3-10H2,1-2H3,(H,27,28)(H,29,30)(H2,31,32,33)/t23-,25+/m1/s1 |
| InChIKey | VYVMCADUAWICHJ-NOZRDPDXSA-N |
| XLogP | 5.53 |
| TPSA | 133.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|