C20H20O4 — CID 54419007
1-[2-hydroxy-5-[(E)-prop-1-enyl]phenyl]-2-(2-hydroxy-5-propylphenyl)ethane-1,2-dione (PubChem CID 54419007) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[(E)-prop-1-enyl]phenyl]-2-(2-hydroxy-5-propylphenyl)ethane-1,2-dione.
| Compound Name | 1-[2-hydroxy-5-[(E)-prop-1-enyl]phenyl]-2-(2-hydroxy-5-propylphenyl)ethane-1,2-dione |
|---|---|
| PubChem CID | 54419007 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | 1-[2-hydroxy-5-[(E)-prop-1-enyl]phenyl]-2-(2-hydroxy-5-propylphenyl)ethane-1,2-dione |
| SMILES | C/C=C/c1ccc(O)c(C(=O)C(=O)c2cc(CCC)ccc2O)c1 |
| InChI | InChI=1S/C20H20O4/c1-3-5-13-7-9-17(21)15(11-13)19(23)20(24)16-12-14(6-4-2)8-10-18(16)22/h3,5,7-12,21-22H,4,6H2,1-2H3/b5-3+ |
| InChIKey | VZMDIZRPQQUAOZ-HWKANZROSA-N |
| XLogP | 4.15 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|