C13H22N6O2S — CID 54421645
1-[amino-[4-(dimethylsulfamoyl)anilino]methylidene]-2-propan-2-ylguanidine (PubChem CID 54421645) has the molecular formula C13H22N6O2S and a molecular weight of 326.43 g/mol. Its IUPAC name is 1-[amino-[4-(dimethylsulfamoyl)anilino]methylidene]-2-propan-2-ylguanidine.
| Compound Name | 1-[amino-[4-(dimethylsulfamoyl)anilino]methylidene]-2-propan-2-ylguanidine |
|---|---|
| PubChem CID | 54421645 |
| Molecular Formula | C13H22N6O2S |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | 1-[amino-[4-(dimethylsulfamoyl)anilino]methylidene]-2-propan-2-ylguanidine |
| SMILES | CC(C)/N=C(\N)N=C(N)Nc1ccc(S(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C13H22N6O2S/c1-9(2)16-12(14)18-13(15)17-10-5-7-11(8-6-10)22(20,21)19(3)4/h5-9H,1-4H3,(H5,14,15,16,17,18) |
| InChIKey | WBFVSBHPJCIDLE-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|