C18H26O6 — CID 54425324
methyl 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoate (PubChem CID 54425324) has the molecular formula C18H26O6 and a molecular weight of 338.40 g/mol. Its IUPAC name is methyl 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoate.
| Compound Name | methyl 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoate |
|---|---|
| PubChem CID | 54425324 |
| Molecular Formula | C18H26O6 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | methyl 7-[(4S,5S)-5-hept-2-ynoyl-2-oxo-1,3-dioxolan-4-yl]heptanoate |
| SMILES | CCCCC#CC(=O)[C@H]1OC(=O)O[C@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C18H26O6/c1-3-4-5-8-11-14(19)17-15(23-18(21)24-17)12-9-6-7-10-13-16(20)22-2/h15,17H,3-7,9-10,12-13H2,1-2H3/t15-,17+/m0/s1 |
| InChIKey | WDRIHZKHLNFORV-DOTOQJQBSA-N |
| XLogP | 3.17 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|