C14H14FN3O3 — CID 54426995
ethyl N-[2-cyano-3-(2-fluoro-4-methylphenyl)iminopropanoyl]carbamate (PubChem CID 54426995) has the molecular formula C14H14FN3O3 and a molecular weight of 291.28 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-(2-fluoro-4-methylphenyl)iminopropanoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-(2-fluoro-4-methylphenyl)iminopropanoyl]carbamate |
|---|---|
| PubChem CID | 54426995 |
| Molecular Formula | C14H14FN3O3 |
| Molecular Weight | 291.28 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | ethyl N-[2-cyano-3-(2-fluoro-4-methylphenyl)iminopropanoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)/C=N/c1ccc(C)cc1F |
| InChI | InChI=1S/C14H14FN3O3/c1-3-21-14(20)18-13(19)10(7-16)8-17-12-5-4-9(2)6-11(12)15/h4-6,8,10H,3H2,1-2H3,(H,18,19,20)/b17-8+ |
| InChIKey | WEUNZAZDJKFDTE-CAOOACKPSA-N |
| XLogP | 2.25 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|