C14H15F3N2O3 — CID 91346196
methyl N-[3-[4-(trifluoromethyl)phenyl]iminopentanoyl]carbamate (PubChem CID 91346196) has the molecular formula C14H15F3N2O3 and a molecular weight of 316.28 g/mol. Its IUPAC name is methyl N-[3-[4-(trifluoromethyl)phenyl]iminopentanoyl]carbamate.
| Compound Name | methyl N-[3-[4-(trifluoromethyl)phenyl]iminopentanoyl]carbamate |
|---|---|
| PubChem CID | 91346196 |
| Molecular Formula | C14H15F3N2O3 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl N-[3-[4-(trifluoromethyl)phenyl]iminopentanoyl]carbamate |
| SMILES | CC/C(CC(=O)NC(=O)OC)=N\c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H15F3N2O3/c1-3-10(8-12(20)19-13(21)22-2)18-11-6-4-9(5-7-11)14(15,16)17/h4-7H,3,8H2,1-2H3,(H,19,20,21)/b18-10+ |
| InChIKey | UHOTUUATEPGHID-VCHYOVAHSA-N |
| XLogP | 3.46 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|