C15H14F3N3O3 — CID 54483191
ethyl N-[2-cyano-3-[2-methyl-4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate (PubChem CID 54483191) has the molecular formula C15H14F3N3O3 and a molecular weight of 341.29 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-[2-methyl-4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-[2-methyl-4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate |
|---|---|
| PubChem CID | 54483191 |
| Molecular Formula | C15H14F3N3O3 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | ethyl N-[2-cyano-3-[2-methyl-4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)/C=N/c1ccc(C(F)(F)F)cc1C |
| InChI | InChI=1S/C15H14F3N3O3/c1-3-24-14(23)21-13(22)10(7-19)8-20-12-5-4-11(6-9(12)2)15(16,17)18/h4-6,8,10H,3H2,1-2H3,(H,21,22,23)/b20-8+ |
| InChIKey | XQLNJWHKNHIAHJ-DNTJNYDQSA-N |
| XLogP | 3.13 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|