C14H12F3N3O3 — CID 54483564
ethyl N-[2-cyano-3-[4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate (PubChem CID 54483564) has the molecular formula C14H12F3N3O3 and a molecular weight of 327.26 g/mol. Its IUPAC name is ethyl N-[2-cyano-3-[4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate.
| Compound Name | ethyl N-[2-cyano-3-[4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate |
|---|---|
| PubChem CID | 54483564 |
| Molecular Formula | C14H12F3N3O3 |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | ethyl N-[2-cyano-3-[4-(trifluoromethyl)phenyl]iminopropanoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(C#N)/C=N/c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H12F3N3O3/c1-2-23-13(22)20-12(21)9(7-18)8-19-11-5-3-10(4-6-11)14(15,16)17/h3-6,8-9H,2H2,1H3,(H,20,21,22)/b19-8+ |
| InChIKey | XQSNPARZDXGHLQ-UFWORHAWSA-N |
| XLogP | 2.82 |
| TPSA | 91.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|