About 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one
4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one (PubChem CID 54431359) has the molecular formula C33H34N2O3
and a molecular weight of 506.65 g/mol. Its IUPAC name is 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one |
| PubChem CID | 54431359 |
| Molecular Formula | C33H34N2O3 |
| Molecular Weight | 506.65 g/mol |
| Exact Mass | 506.26 |
| IUPAC Name | 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one |
| SMILES | CC1(Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)C(=O)NCCN1Cc1ccccc1 |
| InChI | InChI=1S/C33H34N2O3/c1-33(32(36)34-19-20-35(33)23-26-11-5-2-6-12-26)22-29-17-18-30(37-24-27-13-7-3-8-14-27)31(21-29)38-25-28-15-9-4-10-16-28/h2-18,21H,19-20,22-25H2,1H3,(H,34,36) |
| InChIKey | WHRWIFTYZKEUJO-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 506.65 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one?
The IUPAC name of 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one (CID 54431359) is 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one.
What is the SMILES notation for 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one?
The canonical SMILES for 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one is CC1(Cc2ccc(OCc3ccccc3)c(OCc3ccccc3)c2)C(=O)NCCN1Cc1ccccc1.
What is the InChIKey of 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one?
The InChIKey is WHRWIFTYZKEUJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34N2O3/c1-33(32(36)34-19-20-35(33)23-26-11-5-2-6-12-26)22-29-17-18-30(37-24-27-13-7-3-8-14-27)31(21-29)38-25-28-15-9-4-10-16-28/h2-18,21H,19-20,22-25H2,1H3,(H,34,36).
What are the key properties of 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one?
4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one has a molecular weight of 506.65 g/mol, XLogP of 5.78, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-3-[[3,4-bis(phenylmethoxy)phenyl]methyl]-3-methylpiperazin-2-one is sourced from PubChem (CID 54431359), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).