About 2,6-dichlorooct-4-ene
2,6-dichlorooct-4-ene (PubChem CID 54432794) has the molecular formula C8H14Cl2
and a molecular weight of 181.11 g/mol. Its IUPAC name is 2,6-dichlorooct-4-ene.
Molecular Properties
| Compound Name | 2,6-dichlorooct-4-ene |
| PubChem CID | 54432794 |
| Molecular Formula | C8H14Cl2 |
| Molecular Weight | 181.11 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 2,6-dichlorooct-4-ene |
| SMILES | CCC(Cl)C=CCC(C)Cl |
| InChI | InChI=1S/C8H14Cl2/c1-3-8(10)6-4-5-7(2)9/h4,6-8H,3,5H2,1-2H3 |
| InChIKey | WIRGSMJHOIFLTM-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.11 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dichlorooct-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dichlorooct-4-ene?
The IUPAC name of 2,6-dichlorooct-4-ene (CID 54432794) is 2,6-dichlorooct-4-ene.
What is the SMILES notation for 2,6-dichlorooct-4-ene?
The canonical SMILES for 2,6-dichlorooct-4-ene is CCC(Cl)C=CCC(C)Cl.
What is the InChIKey of 2,6-dichlorooct-4-ene?
The InChIKey is WIRGSMJHOIFLTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14Cl2/c1-3-8(10)6-4-5-7(2)9/h4,6-8H,3,5H2,1-2H3.
What are the key properties of 2,6-dichlorooct-4-ene?
2,6-dichlorooct-4-ene has a molecular weight of 181.11 g/mol, XLogP of 3.58, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dichlorooct-4-ene is sourced from PubChem (CID 54432794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).