C9H8N6O — CID 54433090
3-pyridin-4-yl-N-(2H-tetrazol-5-yl)prop-2-enamide (PubChem CID 54433090) has the molecular formula C9H8N6O and a molecular weight of 216.20 g/mol. Its IUPAC name is 3-pyridin-4-yl-N-(2H-tetrazol-5-yl)prop-2-enamide.
| Compound Name | 3-pyridin-4-yl-N-(2H-tetrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54433090 |
| Molecular Formula | C9H8N6O |
| Molecular Weight | 216.20 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 3-pyridin-4-yl-N-(2H-tetrazol-5-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccncc1)Nc1nn[nH]n1 |
| InChI | InChI=1S/C9H8N6O/c16-8(11-9-12-14-15-13-9)2-1-7-3-5-10-6-4-7/h1-6H,(H2,11,12,13,14,15,16) |
| InChIKey | WIWLJPCQCUBVMM-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.20 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|