C11H9N5O2 — CID 70156613
(E)-2-oxo-4-phenyl-N-(2H-tetrazol-5-yl)but-3-enamide (PubChem CID 70156613) has the molecular formula C11H9N5O2 and a molecular weight of 243.23 g/mol. Its IUPAC name is (E)-2-oxo-4-phenyl-N-(2H-tetrazol-5-yl)but-3-enamide.
| Compound Name | (E)-2-oxo-4-phenyl-N-(2H-tetrazol-5-yl)but-3-enamide |
|---|---|
| PubChem CID | 70156613 |
| Molecular Formula | C11H9N5O2 |
| Molecular Weight | 243.23 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | (E)-2-oxo-4-phenyl-N-(2H-tetrazol-5-yl)but-3-enamide |
| SMILES | O=C(/C=C/c1ccccc1)C(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C11H9N5O2/c17-9(7-6-8-4-2-1-3-5-8)10(18)12-11-13-15-16-14-11/h1-7H,(H2,12,13,14,15,16,18)/b7-6+ |
| InChIKey | IWXFWMRWHPETAU-VOTSOKGWSA-N |
| XLogP | 0.42 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.23 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|