C10H10N6O — CID 54502758
3-(3-methyl-4-pyridinyl)-N-(2H-tetrazol-5-yl)prop-2-enamide (PubChem CID 54502758) has the molecular formula C10H10N6O and a molecular weight of 230.23 g/mol. Its IUPAC name is 3-(3-methyl-4-pyridinyl)-N-(2H-tetrazol-5-yl)prop-2-enamide.
| Compound Name | 3-(3-methyl-4-pyridinyl)-N-(2H-tetrazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 54502758 |
| Molecular Formula | C10H10N6O |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.09 |
| IUPAC Name | 3-(3-methyl-4-pyridinyl)-N-(2H-tetrazol-5-yl)prop-2-enamide |
| SMILES | Cc1cnccc1C=CC(=O)Nc1nn[nH]n1 |
| InChI | InChI=1S/C10H10N6O/c1-7-6-11-5-4-8(7)2-3-9(17)12-10-13-15-16-14-10/h2-6H,1H3,(H2,12,13,14,15,16,17) |
| InChIKey | YDPGGFCFVAQSNC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|