C32H54O11Si — CID 54434350
[(10S)-12-ethylperoxy-1,15-dihydroxy-2-(methoxymethoxy)-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate (PubChem CID 54434350) has the molecular formula C32H54O11Si and a molecular weight of 642.86 g/mol. Its IUPAC name is [(10S)-12-ethylperoxy-1,15-dihydroxy-2-(methoxymethoxy)-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate.
| Compound Name | [(10S)-12-ethylperoxy-1,15-dihydroxy-2-(methoxymethoxy)-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
|---|---|
| PubChem CID | 54434350 |
| Molecular Formula | C32H54O11Si |
| Molecular Weight | 642.86 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | [(10S)-12-ethylperoxy-1,15-dihydroxy-2-(methoxymethoxy)-10,14,17,17-tetramethyl-11-oxo-9-triethylsilyloxy-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl] acetate |
| SMILES | CCOOC1C(=O)[C@]2(C)C(O[Si](CC)(CC)CC)CC3OCC3(OC(C)=O)C2C(OCOC)C2(O)CC(O)C(C)=C1C2(C)C |
| InChI | InChI=1S/C32H54O11Si/c1-11-40-42-25-24-19(5)21(34)16-32(36,29(24,7)8)28(39-18-37-10)26-30(9,27(25)35)22(43-44(12-2,13-3)14-4)15-23-31(26,17-38-23)41-20(6)33/h21-23,25-26,28,34,36H,11-18H2,1-10H3/t21?,22?,23?,25?,26?,28?,30-,31?,32?/m1/s1 |
| InChIKey | WJRUASOVKDRMRH-VENNAFCXSA-N |
| XLogP | 3.85 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.86 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|