C18H22N2O5 — CID 54435173
2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-phenylpentanamide (PubChem CID 54435173) has the molecular formula C18H22N2O5 and a molecular weight of 346.38 g/mol. Its IUPAC name is 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-phenylpentanamide.
| Compound Name | 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-phenylpentanamide |
|---|---|
| PubChem CID | 54435173 |
| Molecular Formula | C18H22N2O5 |
| Molecular Weight | 346.38 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 2-(5,5-dimethyl-2,4-dioxo-1,3-oxazolidin-3-yl)-4,4-dimethyl-3-oxo-N-phenylpentanamide |
| SMILES | CC(C)(C)C(=O)C(C(=O)Nc1ccccc1)N1C(=O)OC(C)(C)C1=O |
| InChI | InChI=1S/C18H22N2O5/c1-17(2,3)13(21)12(14(22)19-11-9-7-6-8-10-11)20-15(23)18(4,5)25-16(20)24/h6-10,12H,1-5H3,(H,19,22) |
| InChIKey | WKFLOHCCPWROLH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|