C12H4Br6O2 — CID 54436904
2,3,4,5-tetrabromo-6-(2,3-dibromo-6-hydroxyphenyl)phenol (PubChem CID 54436904) has the molecular formula C12H4Br6O2 and a molecular weight of 659.59 g/mol. Its IUPAC name is 2,3,4,5-tetrabromo-6-(2,3-dibromo-6-hydroxyphenyl)phenol.
| Compound Name | 2,3,4,5-tetrabromo-6-(2,3-dibromo-6-hydroxyphenyl)phenol |
|---|---|
| PubChem CID | 54436904 |
| Molecular Formula | C12H4Br6O2 |
| Molecular Weight | 659.59 g/mol |
| Exact Mass | 653.53 |
| IUPAC Name | 2,3,4,5-tetrabromo-6-(2,3-dibromo-6-hydroxyphenyl)phenol |
| SMILES | Oc1ccc(Br)c(Br)c1-c1c(O)c(Br)c(Br)c(Br)c1Br |
| InChI | InChI=1S/C12H4Br6O2/c13-3-1-2-4(19)5(7(3)14)6-8(15)9(16)10(17)11(18)12(6)20/h1-2,19-20H |
| InChIKey | WLJGZKUFUYRNIL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.59 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|