C14H10Br4O2 — CID 90998864
2,6-dibromo-3-[1-(2,4-dibromo-3-hydroxyphenyl)ethyl]phenol (PubChem CID 90998864) has the molecular formula C14H10Br4O2 and a molecular weight of 529.85 g/mol. Its IUPAC name is 2,6-dibromo-3-[1-(2,4-dibromo-3-hydroxyphenyl)ethyl]phenol.
| Compound Name | 2,6-dibromo-3-[1-(2,4-dibromo-3-hydroxyphenyl)ethyl]phenol |
|---|---|
| PubChem CID | 90998864 |
| Molecular Formula | C14H10Br4O2 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 525.74 |
| IUPAC Name | 2,6-dibromo-3-[1-(2,4-dibromo-3-hydroxyphenyl)ethyl]phenol |
| SMILES | CC(c1ccc(Br)c(O)c1Br)c1ccc(Br)c(O)c1Br |
| InChI | InChI=1S/C14H10Br4O2/c1-6(7-2-4-9(15)13(19)11(7)17)8-3-5-10(16)14(20)12(8)18/h2-6,19-20H,1H3 |
| InChIKey | MVLBFDZLLGNUHG-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |