C6H2Br5NaO — CID 173454659
sodium;hydride;2,3,4,5,6-pentabromophenol (PubChem CID 173454659) has the molecular formula C6H2Br5NaO and a molecular weight of 512.59 g/mol. Its IUPAC name is sodium;hydride;2,3,4,5,6-pentabromophenol.
| Compound Name | sodium;hydride;2,3,4,5,6-pentabromophenol |
|---|---|
| PubChem CID | 173454659 |
| Molecular Formula | C6H2Br5NaO |
| Molecular Weight | 512.59 g/mol |
| Exact Mass | 507.59 |
| IUPAC Name | sodium;hydride;2,3,4,5,6-pentabromophenol |
| SMILES | Oc1c(Br)c(Br)c(Br)c(Br)c1Br.[H-].[Na+] |
| InChI | InChI=1S/C6HBr5O.Na.H/c7-1-2(8)4(10)6(12)5(11)3(1)9;;/h12H;;/q;+1;-1 |
| InChIKey | XOHLAFNMZVKFGX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.59 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|