About methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate
methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate (PubChem CID 54438634) has the molecular formula C7H10N2O3S2
and a molecular weight of 234.30 g/mol. Its IUPAC name is methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate.
Molecular Properties
| Compound Name | methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate |
| PubChem CID | 54438634 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate |
| SMILES | COS(=O)c1sc(NC(C)=O)nc1C |
| InChI | InChI=1S/C7H10N2O3S2/c1-4-6(14(11)12-3)13-7(8-4)9-5(2)10/h1-3H3,(H,8,9,10) |
| InChIKey | WMMYRHIAJSHKKD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate?
The IUPAC name of methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate (CID 54438634) is methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate.
What is the SMILES notation for methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate?
The canonical SMILES for methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate is COS(=O)c1sc(NC(C)=O)nc1C.
What is the InChIKey of methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate?
The InChIKey is WMMYRHIAJSHKKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3S2/c1-4-6(14(11)12-3)13-7(8-4)9-5(2)10/h1-3H3,(H,8,9,10).
What are the key properties of methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate?
methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate has a molecular weight of 234.30 g/mol, XLogP of 1.08, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate is sourced from PubChem (CID 54438634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).