C7H10N2O3S2 — CID 54438634
methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate (PubChem CID 54438634) has the molecular formula C7H10N2O3S2 and a molecular weight of 234.30 g/mol. Its IUPAC name is methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate.
| Compound Name | methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate |
|---|---|
| PubChem CID | 54438634 |
| Molecular Formula | C7H10N2O3S2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.01 |
| IUPAC Name | methyl 2-acetamido-4-methyl-1,3-thiazole-5-sulfinate |
| SMILES | COS(=O)c1sc(NC(C)=O)nc1C |
| InChI | InChI=1S/C7H10N2O3S2/c1-4-6(14(11)12-3)13-7(8-4)9-5(2)10/h1-3H3,(H,8,9,10) |
| InChIKey | WMMYRHIAJSHKKD-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |