C8H14N4O4S2 — CID 87281931
N-[5-(2-aminooxyethylsulfamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide (PubChem CID 87281931) has the molecular formula C8H14N4O4S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is N-[5-(2-aminooxyethylsulfamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[5-(2-aminooxyethylsulfamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87281931 |
| Molecular Formula | C8H14N4O4S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | N-[5-(2-aminooxyethylsulfamoyl)-4-methyl-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(C)c(S(=O)(=O)NCCON)s1 |
| InChI | InChI=1S/C8H14N4O4S2/c1-5-7(17-8(11-5)12-6(2)13)18(14,15)10-3-4-16-9/h10H,3-4,9H2,1-2H3,(H,11,12,13) |
| InChIKey | MFICNMPFGFPORS-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|