C27H29N5O4 — CID 54439553
3-[7-[4-(dimethylamino)butoxy]-4-[(6-methoxyquinolin-8-yl)amino]quinazolin-6-yl]prop-2-enoic acid (PubChem CID 54439553) has the molecular formula C27H29N5O4 and a molecular weight of 487.56 g/mol. Its IUPAC name is 3-[7-[4-(dimethylamino)butoxy]-4-[(6-methoxyquinolin-8-yl)amino]quinazolin-6-yl]prop-2-enoic acid.
| Compound Name | 3-[7-[4-(dimethylamino)butoxy]-4-[(6-methoxyquinolin-8-yl)amino]quinazolin-6-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54439553 |
| Molecular Formula | C27H29N5O4 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.22 |
| IUPAC Name | 3-[7-[4-(dimethylamino)butoxy]-4-[(6-methoxyquinolin-8-yl)amino]quinazolin-6-yl]prop-2-enoic acid |
| SMILES | COc1cc(Nc2ncnc3cc(OCCCCN(C)C)c(C=CC(=O)O)cc23)c2ncccc2c1 |
| InChI | InChI=1S/C27H29N5O4/c1-32(2)11-4-5-12-36-24-16-22-21(14-18(24)8-9-25(33)34)27(30-17-29-22)31-23-15-20(35-3)13-19-7-6-10-28-26(19)23/h6-10,13-17H,4-5,11-12H2,1-3H3,(H,33,34)(H,29,30,31) |
| InChIKey | WNCPSCFXYPRWLD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 109.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|