C31H34N4O6 — CID 175098051
(E)-3-[2-[[6-[3-(dimethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]-3-methoxy-4-phenylmethoxyphenyl]prop-2-enoic acid (PubChem CID 175098051) has the molecular formula C31H34N4O6 and a molecular weight of 558.64 g/mol. Its IUPAC name is (E)-3-[2-[[6-[3-(dimethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]-3-methoxy-4-phenylmethoxyphenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[[6-[3-(dimethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]-3-methoxy-4-phenylmethoxyphenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175098051 |
| Molecular Formula | C31H34N4O6 |
| Molecular Weight | 558.64 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | (E)-3-[2-[[6-[3-(dimethylamino)propoxy]-7-methoxyquinazolin-4-yl]amino]-3-methoxy-4-phenylmethoxyphenyl]prop-2-enoic acid |
| SMILES | COc1cc2ncnc(Nc3c(/C=C/C(=O)O)ccc(OCc4ccccc4)c3OC)c2cc1OCCCN(C)C |
| InChI | InChI=1S/C31H34N4O6/c1-35(2)15-8-16-40-27-17-23-24(18-26(27)38-3)32-20-33-31(23)34-29-22(12-14-28(36)37)11-13-25(30(29)39-4)41-19-21-9-6-5-7-10-21/h5-7,9-14,17-18,20H,8,15-16,19H2,1-4H3,(H,36,37)(H,32,33,34)/b14-12+ |
| InChIKey | FBRIMTCCGCGIJP-WYMLVPIESA-N |
| XLogP | 5.40 |
| TPSA | 115.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.64 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|