C22H26N2O2S — CID 54441622
1-[4-(4-butoxyphenyl)sulfanylphenyl]-3-imidazol-1-ylpropan-1-ol (PubChem CID 54441622) has the molecular formula C22H26N2O2S and a molecular weight of 382.53 g/mol. Its IUPAC name is 1-[4-(4-butoxyphenyl)sulfanylphenyl]-3-imidazol-1-ylpropan-1-ol.
| Compound Name | 1-[4-(4-butoxyphenyl)sulfanylphenyl]-3-imidazol-1-ylpropan-1-ol |
|---|---|
| PubChem CID | 54441622 |
| Molecular Formula | C22H26N2O2S |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 1-[4-(4-butoxyphenyl)sulfanylphenyl]-3-imidazol-1-ylpropan-1-ol |
| SMILES | CCCCOc1ccc(Sc2ccc(C(O)CCn3ccnc3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O2S/c1-2-3-16-26-19-6-10-21(11-7-19)27-20-8-4-18(5-9-20)22(25)12-14-24-15-13-23-17-24/h4-11,13,15,17,22,25H,2-3,12,14,16H2,1H3 |
| InChIKey | WOMRBVGSGGMAAM-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|