C19H31NO3 — CID 82073803
1-(4-butoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)propan-1-ol (PubChem CID 82073803) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)propan-1-ol.
| Compound Name | 1-(4-butoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)propan-1-ol |
|---|---|
| PubChem CID | 82073803 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | 1-(4-butoxyphenyl)-3-(2,6-dimethylmorpholin-4-yl)propan-1-ol |
| SMILES | CCCCOc1ccc(C(O)CCN2CC(C)OC(C)C2)cc1 |
| InChI | InChI=1S/C19H31NO3/c1-4-5-12-22-18-8-6-17(7-9-18)19(21)10-11-20-13-15(2)23-16(3)14-20/h6-9,15-16,19,21H,4-5,10-14H2,1-3H3 |
| InChIKey | OBELFEJNTCQMJP-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|