C17H21N3 — CID 54446707
N,N-diethyl-2-(phenyldiazenylmethyl)aniline (PubChem CID 54446707) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is N,N-diethyl-2-(phenyldiazenylmethyl)aniline.
| Compound Name | N,N-diethyl-2-(phenyldiazenylmethyl)aniline |
|---|---|
| PubChem CID | 54446707 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | N,N-diethyl-2-(phenyldiazenylmethyl)aniline |
| SMILES | CCN(CC)c1ccccc1C/N=N/c1ccccc1 |
| InChI | InChI=1S/C17H21N3/c1-3-20(4-2)17-13-9-8-10-15(17)14-18-19-16-11-6-5-7-12-16/h5-13H,3-4,14H2,1-2H3/b19-18+ |
| InChIKey | WSAGITSESHUZRM-VHEBQXMUSA-N |
| XLogP | 4.82 |
| TPSA | 27.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|