C23H31NO3 — CID 54449161
N-(4-butylphenyl)-5-(2,4-dihydroxyphenyl)-5-methylhexanamide (PubChem CID 54449161) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is N-(4-butylphenyl)-5-(2,4-dihydroxyphenyl)-5-methylhexanamide.
| Compound Name | N-(4-butylphenyl)-5-(2,4-dihydroxyphenyl)-5-methylhexanamide |
|---|---|
| PubChem CID | 54449161 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-(4-butylphenyl)-5-(2,4-dihydroxyphenyl)-5-methylhexanamide |
| SMILES | CCCCc1ccc(NC(=O)CCCC(C)(C)c2ccc(O)cc2O)cc1 |
| InChI | InChI=1S/C23H31NO3/c1-4-5-7-17-9-11-18(12-10-17)24-22(27)8-6-15-23(2,3)20-14-13-19(25)16-21(20)26/h9-14,16,25-26H,4-8,15H2,1-3H3,(H,24,27) |
| InChIKey | WTSBTMVLSCNWIL-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |