C9H10N2O4 — CID 54454514
2-N,6-N-dimethyl-4-oxopyran-2,6-dicarboxamide (PubChem CID 54454514) has the molecular formula C9H10N2O4 and a molecular weight of 210.19 g/mol. Its IUPAC name is 2-N,6-N-dimethyl-4-oxopyran-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-dimethyl-4-oxopyran-2,6-dicarboxamide |
|---|---|
| PubChem CID | 54454514 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 2-N,6-N-dimethyl-4-oxopyran-2,6-dicarboxamide |
| SMILES | CNC(=O)c1cc(=O)cc(C(=O)NC)o1 |
| InChI | InChI=1S/C9H10N2O4/c1-10-8(13)6-3-5(12)4-7(15-6)9(14)11-2/h3-4H,1-2H3,(H,10,13)(H,11,14) |
| InChIKey | WXFNDOKKYSJRCJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |