C18H16BrN5O2S2 — CID 54454774
1-[(4-aminothieno[3,2-d]pyrimidin-6-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]piperazin-2-one (PubChem CID 54454774) has the molecular formula C18H16BrN5O2S2 and a molecular weight of 478.40 g/mol. Its IUPAC name is 1-[(4-aminothieno[3,2-d]pyrimidin-6-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]piperazin-2-one.
| Compound Name | 1-[(4-aminothieno[3,2-d]pyrimidin-6-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]piperazin-2-one |
|---|---|
| PubChem CID | 54454774 |
| Molecular Formula | C18H16BrN5O2S2 |
| Molecular Weight | 478.40 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | 1-[(4-aminothieno[3,2-d]pyrimidin-6-yl)methyl]-4-[3-(4-bromothiophen-2-yl)prop-2-enoyl]piperazin-2-one |
| SMILES | Nc1ncnc2cc(CN3CCN(C(=O)C=Cc4cc(Br)cs4)CC3=O)sc12 |
| InChI | InChI=1S/C18H16BrN5O2S2/c19-11-5-12(27-9-11)1-2-15(25)24-4-3-23(16(26)8-24)7-13-6-14-17(28-13)18(20)22-10-21-14/h1-2,5-6,9-10H,3-4,7-8H2,(H2,20,21,22) |
| InChIKey | WXKMOWPYULQBMB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|