C52H50N4 — CID 54455991
5,10,15,20-tetrakis(4-ethylphenyl)-2,3,12,13,22,24-hexahydroporphyrin (PubChem CID 54455991) has the molecular formula C52H50N4 and a molecular weight of 731.00 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(4-ethylphenyl)-2,3,12,13,22,24-hexahydroporphyrin.
| Compound Name | 5,10,15,20-tetrakis(4-ethylphenyl)-2,3,12,13,22,24-hexahydroporphyrin |
|---|---|
| PubChem CID | 54455991 |
| Molecular Formula | C52H50N4 |
| Molecular Weight | 731.00 g/mol |
| Exact Mass | 730.40 |
| IUPAC Name | 5,10,15,20-tetrakis(4-ethylphenyl)-2,3,12,13,22,24-hexahydroporphyrin |
| SMILES | CCc1ccc(-c2c3nc(c(-c4ccc(CC)cc4)c4ccc([nH]4)c(-c4ccc(CC)cc4)c4nc(c(-c5ccc(CC)cc5)c5ccc2[nH]5)CC4)CC3)cc1 |
| InChI | InChI=1S/C52H50N4/c1-5-33-9-17-37(18-10-33)49-41-25-27-43(53-41)50(38-19-11-34(6-2)12-20-38)45-29-31-47(55-45)52(40-23-15-36(8-4)16-24-40)48-32-30-46(56-48)51(44-28-26-42(49)54-44)39-21-13-35(7-3)14-22-39/h9-25,27,30,32,53,56H,5-8,26,28-29,31H2,1-4H3/b49-41-,49-42-,50-43-,50-45-,51-44-,51-46-,52-47-,52-48- |
| InChIKey | WYFPKWWZBNCZJY-RCOMQYLTSA-N |
| XLogP | 12.80 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.00 |
| LogP ≤ 5 | 12.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |