C21H21ClN2O6S — CID 54456826
3-methylsulfonyloxypropyl 7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepine-3-carboxylate (PubChem CID 54456826) has the molecular formula C21H21ClN2O6S and a molecular weight of 464.93 g/mol. Its IUPAC name is 3-methylsulfonyloxypropyl 7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepine-3-carboxylate.
| Compound Name | 3-methylsulfonyloxypropyl 7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepine-3-carboxylate |
|---|---|
| PubChem CID | 54456826 |
| Molecular Formula | C21H21ClN2O6S |
| Molecular Weight | 464.93 g/mol |
| Exact Mass | 464.08 |
| IUPAC Name | 3-methylsulfonyloxypropyl 7-chloro-1-methyl-2-oxo-5-phenyl-3H-1,4-benzodiazepine-3-carboxylate |
| SMILES | CN1C(=O)C(C(=O)OCCCOS(C)(=O)=O)N=C(c2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C21H21ClN2O6S/c1-24-17-10-9-15(22)13-16(17)18(14-7-4-3-5-8-14)23-19(20(24)25)21(26)29-11-6-12-30-31(2,27)28/h3-5,7-10,13,19H,6,11-12H2,1-2H3 |
| InChIKey | WYTXRHSZLVFHFT-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 102.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.93 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|