C26H40O2 — CID 54459846
(4-ethylcyclohexyl) 4-[(1R,2R)-4-butyl-2-methylcyclohexyl]benzoate (PubChem CID 54459846) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is (4-ethylcyclohexyl) 4-[(1R,2R)-4-butyl-2-methylcyclohexyl]benzoate.
| Compound Name | (4-ethylcyclohexyl) 4-[(1R,2R)-4-butyl-2-methylcyclohexyl]benzoate |
|---|---|
| PubChem CID | 54459846 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | (4-ethylcyclohexyl) 4-[(1R,2R)-4-butyl-2-methylcyclohexyl]benzoate |
| SMILES | CCCCC1CC[C@@H](c2ccc(C(=O)OC3CCC(CC)CC3)cc2)[C@H](C)C1 |
| InChI | InChI=1S/C26H40O2/c1-4-6-7-21-10-17-25(19(3)18-21)22-11-13-23(14-12-22)26(27)28-24-15-8-20(5-2)9-16-24/h11-14,19-21,24-25H,4-10,15-18H2,1-3H3/t19-,20?,21?,24?,25-/m1/s1 |
| InChIKey | XAVVRTSPJMNJHH-OUNJDDEJSA-N |
| XLogP | 7.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |