C14H29NO — CID 54461411
N,N,6-trimethylundec-9-en-1-amine oxide (PubChem CID 54461411) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is N,N,6-trimethylundec-9-en-1-amine oxide.
| Compound Name | N,N,6-trimethylundec-9-en-1-amine oxide |
|---|---|
| PubChem CID | 54461411 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | N,N,6-trimethylundec-9-en-1-amine oxide |
| SMILES | CC=CCCC(C)CCCCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C14H29NO/c1-5-6-8-11-14(2)12-9-7-10-13-15(3,4)16/h5-6,14H,7-13H2,1-4H3 |
| InChIKey | XBWKNXPWDTXDGJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|