C18H39NO — CID 58133406
N,N,4,8,12-pentamethyltridecan-1-amine oxide (PubChem CID 58133406) has the molecular formula C18H39NO and a molecular weight of 285.52 g/mol. Its IUPAC name is N,N,4,8,12-pentamethyltridecan-1-amine oxide.
| Compound Name | N,N,4,8,12-pentamethyltridecan-1-amine oxide |
|---|---|
| PubChem CID | 58133406 |
| Molecular Formula | C18H39NO |
| Molecular Weight | 285.52 g/mol |
| Exact Mass | 285.30 |
| IUPAC Name | N,N,4,8,12-pentamethyltridecan-1-amine oxide |
| SMILES | CC(C)CCCC(C)CCCC(C)CCC[N+](C)(C)[O-] |
| InChI | InChI=1S/C18H39NO/c1-16(2)10-7-11-17(3)12-8-13-18(4)14-9-15-19(5,6)20/h16-18H,7-15H2,1-6H3 |
| InChIKey | XSIXEXBXKRJNFV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.52 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|