C10H27NO — CID 157348298
methane;N,N,3-trimethylpentan-1-amine oxide (PubChem CID 157348298) has the molecular formula C10H27NO and a molecular weight of 177.33 g/mol. Its IUPAC name is methane;N,N,3-trimethylpentan-1-amine oxide.
| Compound Name | methane;N,N,3-trimethylpentan-1-amine oxide |
|---|---|
| PubChem CID | 157348298 |
| Molecular Formula | C10H27NO |
| Molecular Weight | 177.33 g/mol |
| Exact Mass | 177.21 |
| IUPAC Name | methane;N,N,3-trimethylpentan-1-amine oxide |
| SMILES | C.C.CCC(C)CC[N+](C)(C)[O-] |
| InChI | InChI=1S/C8H19NO.2CH4/c1-5-8(2)6-7-9(3,4)10;;/h8H,5-7H2,1-4H3;2*1H4 |
| InChIKey | BHFRFQGBPFGUNM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.33 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|