C12H16F2O2 — CID 54466600
4-(2-bicyclo[2.2.1]heptanyl)-4,4-difluoro-2-methylidenebutanoic acid (PubChem CID 54466600) has the molecular formula C12H16F2O2 and a molecular weight of 230.25 g/mol. Its IUPAC name is 4-(2-bicyclo[2.2.1]heptanyl)-4,4-difluoro-2-methylidenebutanoic acid.
| Compound Name | 4-(2-bicyclo[2.2.1]heptanyl)-4,4-difluoro-2-methylidenebutanoic acid |
|---|---|
| PubChem CID | 54466600 |
| Molecular Formula | C12H16F2O2 |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 4-(2-bicyclo[2.2.1]heptanyl)-4,4-difluoro-2-methylidenebutanoic acid |
| SMILES | C=C(CC(F)(F)C1CC2CCC1C2)C(=O)O |
| InChI | InChI=1S/C12H16F2O2/c1-7(11(15)16)6-12(13,14)10-5-8-2-3-9(10)4-8/h8-10H,1-6H2,(H,15,16) |
| InChIKey | XFIALHJJWXMVPQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|