C15H12Cl2F3N3O3 — CID 54472339
methyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(dimethylaminomethylidene)-5-oxopyrazole-3-carboxylate (PubChem CID 54472339) has the molecular formula C15H12Cl2F3N3O3 and a molecular weight of 410.18 g/mol. Its IUPAC name is methyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(dimethylaminomethylidene)-5-oxopyrazole-3-carboxylate.
| Compound Name | methyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(dimethylaminomethylidene)-5-oxopyrazole-3-carboxylate |
|---|---|
| PubChem CID | 54472339 |
| Molecular Formula | C15H12Cl2F3N3O3 |
| Molecular Weight | 410.18 g/mol |
| Exact Mass | 409.02 |
| IUPAC Name | methyl 1-[2,6-dichloro-4-(trifluoromethyl)phenyl]-4-(dimethylaminomethylidene)-5-oxopyrazole-3-carboxylate |
| SMILES | COC(=O)C1=NN(c2c(Cl)cc(C(F)(F)F)cc2Cl)C(=O)C1=CN(C)C |
| InChI | InChI=1S/C15H12Cl2F3N3O3/c1-22(2)6-8-11(14(25)26-3)21-23(13(8)24)12-9(16)4-7(5-10(12)17)15(18,19)20/h4-6H,1-3H3 |
| InChIKey | XJFBPLBZJYDTOS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.18 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|