C14H29O5P — CID 54472647
diethyl (7-hydroxy-3,7-dimethyloct-1-enyl) phosphate (PubChem CID 54472647) has the molecular formula C14H29O5P and a molecular weight of 308.36 g/mol. Its IUPAC name is diethyl (7-hydroxy-3,7-dimethyloct-1-enyl) phosphate.
| Compound Name | diethyl (7-hydroxy-3,7-dimethyloct-1-enyl) phosphate |
|---|---|
| PubChem CID | 54472647 |
| Molecular Formula | C14H29O5P |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.18 |
| IUPAC Name | diethyl (7-hydroxy-3,7-dimethyloct-1-enyl) phosphate |
| SMILES | CCOP(=O)(OC=CC(C)CCCC(C)(C)O)OCC |
| InChI | InChI=1S/C14H29O5P/c1-6-17-20(16,18-7-2)19-12-10-13(3)9-8-11-14(4,5)15/h10,12-13,15H,6-9,11H2,1-5H3 |
| InChIKey | XJJZRQCVMVHZMQ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|