C42H44N2O6 — CID 54480135
cyclobutane-1,3-dione;1-methylazetidine-2,4-dione;3-[[1,1,1',1'-tetramethyl-5-(3-methylphenoxy)-3,3'-spirobi[2H-indene]-5'-yl]oxy]aniline (PubChem CID 54480135) has the molecular formula C42H44N2O6 and a molecular weight of 672.82 g/mol. Its IUPAC name is cyclobutane-1,3-dione;1-methylazetidine-2,4-dione;3-[[1,1,1',1'-tetramethyl-5-(3-methylphenoxy)-3,3'-spirobi[2H-indene]-5'-yl]oxy]aniline.
| Compound Name | cyclobutane-1,3-dione;1-methylazetidine-2,4-dione;3-[[1,1,1',1'-tetramethyl-5-(3-methylphenoxy)-3,3'-spirobi[2H-indene]-5'-yl]oxy]aniline |
|---|---|
| PubChem CID | 54480135 |
| Molecular Formula | C42H44N2O6 |
| Molecular Weight | 672.82 g/mol |
| Exact Mass | 672.32 |
| IUPAC Name | cyclobutane-1,3-dione;1-methylazetidine-2,4-dione;3-[[1,1,1',1'-tetramethyl-5-(3-methylphenoxy)-3,3'-spirobi[2H-indene]-5'-yl]oxy]aniline |
| SMILES | CN1C(=O)CC1=O.Cc1cccc(Oc2ccc3c(c2)C2(CC3(C)C)CC(C)(C)c3ccc(Oc4cccc(N)c4)cc32)c1.O=C1CC(=O)C1 |
| InChI | InChI=1S/C34H35NO2.C4H5NO2.C4H4O2/c1-22-8-6-10-24(16-22)36-26-12-14-28-30(18-26)34(20-32(28,2)3)21-33(4,5)29-15-13-27(19-31(29)34)37-25-11-7-9-23(35)17-25;1-5-3(6)2-4(5)7;5-3-1-4(6)2-3/h6-19H,20-21,35H2,1-5H3;2H2,1H3;1-2H2 |
| InChIKey | XOKPQOANPOAYAF-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.82 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|