C35H38N2O2 — CID 171479639
4-[[5'-(4-amino-3-methylphenoxy)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]-2-methylaniline (PubChem CID 171479639) has the molecular formula C35H38N2O2 and a molecular weight of 518.70 g/mol. Its IUPAC name is 4-[[5'-(4-amino-3-methylphenoxy)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]-2-methylaniline.
| Compound Name | 4-[[5'-(4-amino-3-methylphenoxy)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]-2-methylaniline |
|---|---|
| PubChem CID | 171479639 |
| Molecular Formula | C35H38N2O2 |
| Molecular Weight | 518.70 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 4-[[5'-(4-amino-3-methylphenoxy)-1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]-2-methylaniline |
| SMILES | Cc1cc(Oc2ccc3c(c2)C2(CC3(C)C)CC(C)(C)c3ccc(Oc4ccc(N)c(C)c4)cc32)ccc1N |
| InChI | InChI=1S/C35H38N2O2/c1-21-15-23(9-13-31(21)36)38-25-7-11-27-29(17-25)35(19-33(27,3)4)20-34(5,6)28-12-8-26(18-30(28)35)39-24-10-14-32(37)22(2)16-24/h7-18H,19-20,36-37H2,1-6H3 |
| InChIKey | OTIHXLYPBIOKLV-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.70 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|