C35H38N2O4 — CID 161312466
2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]phenol (PubChem CID 161312466) has the molecular formula C35H38N2O4 and a molecular weight of 550.70 g/mol. Its IUPAC name is 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]phenol.
| Compound Name | 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]phenol |
|---|---|
| PubChem CID | 161312466 |
| Molecular Formula | C35H38N2O4 |
| Molecular Weight | 550.70 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-1,1,1',1',6,6'-hexamethyl-3,3'-spirobi[2H-indene]-5-yl]oxy]phenol |
| SMILES | Cc1cc2c(cc1Oc1ccc(N)c(O)c1)C1(CC2(C)C)CC(C)(C)c2cc(C)c(Oc3ccc(N)c(O)c3)cc21 |
| InChI | InChI=1S/C35H38N2O4/c1-19-11-23-25(15-31(19)40-21-7-9-27(36)29(38)13-21)35(17-33(23,3)4)18-34(5,6)24-12-20(2)32(16-26(24)35)41-22-8-10-28(37)30(39)14-22/h7-16,38-39H,17-18,36-37H2,1-6H3 |
| InChIKey | VJBLVHHCFXMOSZ-UHFFFAOYSA-N |
| XLogP | 8.11 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.70 |
| LogP ≤ 5 | 8.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|