C35H38N2O6 — CID 158885006
2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-5-yl]oxy]phenol (PubChem CID 158885006) has the molecular formula C35H38N2O6 and a molecular weight of 582.70 g/mol. Its IUPAC name is 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-5-yl]oxy]phenol.
| Compound Name | 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-5-yl]oxy]phenol |
|---|---|
| PubChem CID | 158885006 |
| Molecular Formula | C35H38N2O6 |
| Molecular Weight | 582.70 g/mol |
| Exact Mass | 582.27 |
| IUPAC Name | 2-amino-5-[[5'-(4-amino-3-hydroxyphenoxy)-4,4,4',4',7,7'-hexamethyl-2,2'-spirobi[3H-chromene]-5-yl]oxy]phenol |
| SMILES | Cc1cc(Oc2ccc(N)c(O)c2)c2c(c1)OC1(CC2(C)C)CC(C)(C)c2c(Oc3ccc(N)c(O)c3)cc(C)cc2O1 |
| InChI | InChI=1S/C35H38N2O6/c1-19-11-27(40-21-7-9-23(36)25(38)15-21)31-29(13-19)42-35(17-33(31,3)4)18-34(5,6)32-28(12-20(2)14-30(32)43-35)41-22-8-10-24(37)26(39)16-22/h7-16,38-39H,17-18,36-37H2,1-6H3 |
| InChIKey | JDNDBMOSXXFCJT-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 129.42 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.70 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|