C36H42N2O4 — CID 142083823
2-amino-5-[[17-(4-amino-3-hydroxyphenoxy)-2,2,8,11,11,16-hexamethyl-7-tricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaenyl]oxy]phenol (PubChem CID 142083823) has the molecular formula C36H42N2O4 and a molecular weight of 566.74 g/mol. Its IUPAC name is 2-amino-5-[[17-(4-amino-3-hydroxyphenoxy)-2,2,8,11,11,16-hexamethyl-7-tricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaenyl]oxy]phenol.
| Compound Name | 2-amino-5-[[17-(4-amino-3-hydroxyphenoxy)-2,2,8,11,11,16-hexamethyl-7-tricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaenyl]oxy]phenol |
|---|---|
| PubChem CID | 142083823 |
| Molecular Formula | C36H42N2O4 |
| Molecular Weight | 566.74 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | 2-amino-5-[[17-(4-amino-3-hydroxyphenoxy)-2,2,8,11,11,16-hexamethyl-7-tricyclo[12.4.0.05,10]octadeca-1(14),5(10),6,8,15,17-hexaenyl]oxy]phenol |
| SMILES | Cc1cc2c(cc1Oc1ccc(N)c(O)c1)CCC(C)(C)c1cc(Oc3ccc(N)c(O)c3)c(C)cc1CCC2(C)C |
| InChI | InChI=1S/C36H42N2O4/c1-21-15-23-11-13-35(3,4)27-16-22(2)33(41-25-7-9-29(37)31(39)18-25)17-24(27)12-14-36(5,6)28(23)20-34(21)42-26-8-10-30(38)32(40)19-26/h7-10,15-20,39-40H,11-14,37-38H2,1-6H3 |
| InChIKey | NBRVEMCOSJWDJV-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 110.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.74 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|