C19H20ClN3O5S — CID 54482702
(2R,3S,4S,5R,6S)-2-[(4-azido-3-chlorophenyl)methoxymethyl]-6-phenylsulfanyloxane-3,4,5-triol (PubChem CID 54482702) has the molecular formula C19H20ClN3O5S and a molecular weight of 437.91 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[(4-azido-3-chlorophenyl)methoxymethyl]-6-phenylsulfanyloxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[(4-azido-3-chlorophenyl)methoxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 54482702 |
| Molecular Formula | C19H20ClN3O5S |
| Molecular Weight | 437.91 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[(4-azido-3-chlorophenyl)methoxymethyl]-6-phenylsulfanyloxane-3,4,5-triol |
| SMILES | [N-]=[N+]=Nc1ccc(COC[C@H]2O[C@@H](Sc3ccccc3)[C@H](O)[C@@H](O)[C@@H]2O)cc1Cl |
| InChI | InChI=1S/C19H20ClN3O5S/c20-13-8-11(6-7-14(13)22-23-21)9-27-10-15-16(24)17(25)18(26)19(28-15)29-12-4-2-1-3-5-12/h1-8,15-19,24-26H,9-10H2/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | XQDJNEWRLGJYKU-FQBWVUSXSA-N |
| XLogP | 3.40 |
| TPSA | 127.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.91 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|